2-bromo-3-nitrobenzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

2-bromo-3-nitrobenzoic acid; 1,2,3-nitrobromobenzoic acid
Links:🕷 ChemSpider, ⚗️ ChemSynthesis
CAS RN:[573-54-6]
Formula:C7H4BrNO4; 246.02 g/mol
InChiKey:WTDJEGSXLFHZPY-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(c1Br)[N+]([O-])=O
Molecular structure of 2-bromo-3-nitrobenzoic acid
Melting point:185 °C
1g dissolves in:
3,030.30g water

Isomers

2-bromo-3-nitrobenzoic acid
Molecular structure of 2-bromo-3-nitrobenzoic acid
2-bromo-5-nitrobenzoic acid
Molecular structure of 2-bromo-5-nitrobenzoic acid
2-bromo-6-nitrobenzoic acid
Molecular structure of 2-bromo-6-nitrobenzoic acid
3-bromo-2-nitrobenzoic acid
Molecular structure of 3-bromo-2-nitrobenzoic acid
3-bromo-4-nitrobenzoic acid
Molecular structure of 3-bromo-4-nitrobenzoic acid
3-bromo-5-nitrobenzoic acid
Molecular structure of 3-bromo-5-nitrobenzoic acid
4-bromo-2-nitrobenzoic acid
Molecular structure of 4-bromo-2-nitrobenzoic acid
4-bromo-3-nitrobenzoic acid
Molecular structure of 4-bromo-3-nitrobenzoic acid
3-bromo-5-nitrosalicylaldehyde
Molecular structure of 3-bromo-5-nitrosalicylaldehyde
5-bromo-3-nitrosalicylaldehyde
Molecular structure of 5-bromo-3-nitrosalicylaldehyde
  ::